C23H22ClNO7 — CID 55311262
(6-chloro-7-ethyl-2-oxochromen-4-yl)methyl 2-acetamido-4,5-dimethoxybenzoate (PubChem CID 55311262) has the molecular formula C23H22ClNO7 and a molecular weight of 459.88 g/mol. Its IUPAC name is (6-chloro-7-ethyl-2-oxochromen-4-yl)methyl 2-acetamido-4,5-dimethoxybenzoate.
| Compound Name | (6-chloro-7-ethyl-2-oxochromen-4-yl)methyl 2-acetamido-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 55311262 |
| Molecular Formula | C23H22ClNO7 |
| Molecular Weight | 459.88 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | (6-chloro-7-ethyl-2-oxochromen-4-yl)methyl 2-acetamido-4,5-dimethoxybenzoate |
| SMILES | CCc1cc2oc(=O)cc(COC(=O)c3cc(OC)c(OC)cc3NC(C)=O)c2cc1Cl |
| InChI | InChI=1S/C23H22ClNO7/c1-5-13-6-19-15(8-17(13)24)14(7-22(27)32-19)11-31-23(28)16-9-20(29-3)21(30-4)10-18(16)25-12(2)26/h6-10H,5,11H2,1-4H3,(H,25,26) |
| InChIKey | IWQOWGWVZWKNDV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 104.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.88 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|