C25H27NO7 — CID 41279510
(7-ethyl-2-oxochromen-4-yl)methyl 4,5-dimethoxy-2-(2-methylpropanoylamino)benzoate (PubChem CID 41279510) has the molecular formula C25H27NO7 and a molecular weight of 453.49 g/mol. Its IUPAC name is (7-ethyl-2-oxochromen-4-yl)methyl 4,5-dimethoxy-2-(2-methylpropanoylamino)benzoate.
| Compound Name | (7-ethyl-2-oxochromen-4-yl)methyl 4,5-dimethoxy-2-(2-methylpropanoylamino)benzoate |
|---|---|
| PubChem CID | 41279510 |
| Molecular Formula | C25H27NO7 |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | (7-ethyl-2-oxochromen-4-yl)methyl 4,5-dimethoxy-2-(2-methylpropanoylamino)benzoate |
| SMILES | CCc1ccc2c(COC(=O)c3cc(OC)c(OC)cc3NC(=O)C(C)C)cc(=O)oc2c1 |
| InChI | InChI=1S/C25H27NO7/c1-6-15-7-8-17-16(10-23(27)33-20(17)9-15)13-32-25(29)18-11-21(30-4)22(31-5)12-19(18)26-24(28)14(2)3/h7-12,14H,6,13H2,1-5H3,(H,26,28) |
| InChIKey | JMSRRBXATGYCHA-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 104.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|