C22H22O7 — CID 8753682
(7-ethyl-2-oxochromen-4-yl)methyl 2,4,5-trimethoxybenzoate (PubChem CID 8753682) has the molecular formula C22H22O7 and a molecular weight of 398.41 g/mol. Its IUPAC name is (7-ethyl-2-oxochromen-4-yl)methyl 2,4,5-trimethoxybenzoate.
| Compound Name | (7-ethyl-2-oxochromen-4-yl)methyl 2,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 8753682 |
| Molecular Formula | C22H22O7 |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | (7-ethyl-2-oxochromen-4-yl)methyl 2,4,5-trimethoxybenzoate |
| SMILES | CCc1ccc2c(COC(=O)c3cc(OC)c(OC)cc3OC)cc(=O)oc2c1 |
| InChI | InChI=1S/C22H22O7/c1-5-13-6-7-15-14(9-21(23)29-18(15)8-13)12-28-22(24)16-10-19(26-3)20(27-4)11-17(16)25-2/h6-11H,5,12H2,1-4H3 |
| InChIKey | NIQOUZBHAPNMKR-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 84.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|