C22H23NO6 — CID 9347183
methyl 2-[(7-ethyl-2-oxochromen-4-yl)methylamino]-4,5-dimethoxybenzoate (PubChem CID 9347183) has the molecular formula C22H23NO6 and a molecular weight of 397.43 g/mol. Its IUPAC name is methyl 2-[(7-ethyl-2-oxochromen-4-yl)methylamino]-4,5-dimethoxybenzoate.
| Compound Name | methyl 2-[(7-ethyl-2-oxochromen-4-yl)methylamino]-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 9347183 |
| Molecular Formula | C22H23NO6 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | methyl 2-[(7-ethyl-2-oxochromen-4-yl)methylamino]-4,5-dimethoxybenzoate |
| SMILES | CCc1ccc2c(CNc3cc(OC)c(OC)cc3C(=O)OC)cc(=O)oc2c1 |
| InChI | InChI=1S/C22H23NO6/c1-5-13-6-7-15-14(9-21(24)29-18(15)8-13)12-23-17-11-20(27-3)19(26-2)10-16(17)22(25)28-4/h6-11,23H,5,12H2,1-4H3 |
| InChIKey | ZMWSBEHSQSKQLY-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|