C23H22O6 — CID 7966052
(7-ethyl-2-oxochromen-4-yl)methyl (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate (PubChem CID 7966052) has the molecular formula C23H22O6 and a molecular weight of 394.42 g/mol. Its IUPAC name is (7-ethyl-2-oxochromen-4-yl)methyl (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate.
| Compound Name | (7-ethyl-2-oxochromen-4-yl)methyl (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7966052 |
| Molecular Formula | C23H22O6 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | (7-ethyl-2-oxochromen-4-yl)methyl (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate |
| SMILES | CCc1ccc2c(COC(=O)/C=C/c3ccc(OC)c(OC)c3)cc(=O)oc2c1 |
| InChI | InChI=1S/C23H22O6/c1-4-15-5-8-18-17(13-23(25)29-20(18)11-15)14-28-22(24)10-7-16-6-9-19(26-2)21(12-16)27-3/h5-13H,4,14H2,1-3H3/b10-7+ |
| InChIKey | SGTNIVSDYXXPLT-JXMROGBWSA-N |
| XLogP | 4.13 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|