C21H19NO7 — CID 10408493
(6,7-dimethoxy-2-oxochromen-4-yl)methyl (E)-3-(6-methoxy-3-pyridinyl)prop-2-enoate (PubChem CID 10408493) has the molecular formula C21H19NO7 and a molecular weight of 397.38 g/mol. Its IUPAC name is (6,7-dimethoxy-2-oxochromen-4-yl)methyl (E)-3-(6-methoxy-3-pyridinyl)prop-2-enoate.
| Compound Name | (6,7-dimethoxy-2-oxochromen-4-yl)methyl (E)-3-(6-methoxy-3-pyridinyl)prop-2-enoate |
|---|---|
| PubChem CID | 10408493 |
| Molecular Formula | C21H19NO7 |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | (6,7-dimethoxy-2-oxochromen-4-yl)methyl (E)-3-(6-methoxy-3-pyridinyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)OCc2cc(=O)oc3cc(OC)c(OC)cc23)cn1 |
| InChI | InChI=1S/C21H19NO7/c1-25-17-9-15-14(8-21(24)29-16(15)10-18(17)26-2)12-28-20(23)7-5-13-4-6-19(27-3)22-11-13/h4-11H,12H2,1-3H3/b7-5+ |
| InChIKey | DTYYOBXTUCRCNF-FNORWQNLSA-N |
| XLogP | 2.97 |
| TPSA | 97.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|