C25H28ClNO7 — CID 45260777
(6,7-dimethoxy-2-oxochromen-4-yl)methyl (E)-3-[4-[2-(dimethylamino)ethoxy]phenyl]prop-2-enoate;hydrochloride (PubChem CID 45260777) has the molecular formula C25H28ClNO7 and a molecular weight of 489.95 g/mol. Its IUPAC name is (6,7-dimethoxy-2-oxochromen-4-yl)methyl (E)-3-[4-[2-(dimethylamino)ethoxy]phenyl]prop-2-enoate;hydrochloride.
| Compound Name | (6,7-dimethoxy-2-oxochromen-4-yl)methyl (E)-3-[4-[2-(dimethylamino)ethoxy]phenyl]prop-2-enoate;hydrochloride |
|---|---|
| PubChem CID | 45260777 |
| Molecular Formula | C25H28ClNO7 |
| Molecular Weight | 489.95 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | (6,7-dimethoxy-2-oxochromen-4-yl)methyl (E)-3-[4-[2-(dimethylamino)ethoxy]phenyl]prop-2-enoate;hydrochloride |
| SMILES | COc1cc2oc(=O)cc(COC(=O)/C=C/c3ccc(OCCN(C)C)cc3)c2cc1OC.Cl |
| InChI | InChI=1S/C25H27NO7.ClH/c1-26(2)11-12-31-19-8-5-17(6-9-19)7-10-24(27)32-16-18-13-25(28)33-21-15-23(30-4)22(29-3)14-20(18)21;/h5-10,13-15H,11-12,16H2,1-4H3;1H/b10-7+; |
| InChIKey | FRQVIPXKJTZKQY-HCUGZAAXSA-N |
| XLogP | 3.93 |
| TPSA | 87.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.95 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|