C13H11O6- — CID 25272422
2-(6,7-dimethoxy-2-oxochromen-4-yl)acetate (PubChem CID 25272422) has the molecular formula C13H11O6- and a molecular weight of 263.22 g/mol. Its IUPAC name is 2-(6,7-dimethoxy-2-oxochromen-4-yl)acetate.
| Compound Name | 2-(6,7-dimethoxy-2-oxochromen-4-yl)acetate |
|---|---|
| PubChem CID | 25272422 |
| Molecular Formula | C13H11O6- |
| Molecular Weight | 263.22 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 2-(6,7-dimethoxy-2-oxochromen-4-yl)acetate |
| SMILES | COc1cc2oc(=O)cc(CC(=O)[O-])c2cc1OC |
| InChI | InChI=1S/C13H12O6/c1-17-10-5-8-7(3-12(14)15)4-13(16)19-9(8)6-11(10)18-2/h4-6H,3H2,1-2H3,(H,14,15)/p-1 |
| InChIKey | UKBVNOUQXDVDDX-UHFFFAOYSA-M |
| XLogP | 0.10 |
| TPSA | 88.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.22 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|