About 6-chloro-4-[[(3,5-dimethyl-1,2-oxazol-4-yl)methyl-methylamino]methyl]-7-ethylchromen-2-one
6-chloro-4-[[(3,5-dimethyl-1,2-oxazol-4-yl)methyl-methylamino]methyl]-7-ethylchromen-2-one (PubChem CID 55680391) has the molecular formula C19H21ClN2O3
and a molecular weight of 360.84 g/mol. Its IUPAC name is 6-chloro-4-[[(3,5-dimethyl-1,2-oxazol-4-yl)methyl-methylamino]methyl]-7-ethylchromen-2-one.
Molecular Properties
| Compound Name | 6-chloro-4-[[(3,5-dimethyl-1,2-oxazol-4-yl)methyl-methylamino]methyl]-7-ethylchromen-2-one |
| PubChem CID | 55680391 |
| Molecular Formula | C19H21ClN2O3 |
| Molecular Weight | 360.84 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 6-chloro-4-[[(3,5-dimethyl-1,2-oxazol-4-yl)methyl-methylamino]methyl]-7-ethylchromen-2-one |
| SMILES | CCc1cc2oc(=O)cc(CN(C)Cc3c(C)noc3C)c2cc1Cl |
| InChI | InChI=1S/C19H21ClN2O3/c1-5-13-6-18-15(8-17(13)20)14(7-19(23)24-18)9-22(4)10-16-11(2)21-25-12(16)3/h6-8H,5,9-10H2,1-4H3 |
| InChIKey | RFNBZONZNWENLD-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 59.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.84 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-4-[[(3,5-dimethyl-1,2-oxazol-4-yl)methyl-methylamino]methyl]-7-ethylchromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-4-[[(3,5-dimethyl-1,2-oxazol-4-yl)methyl-methylamino]methyl]-7-ethylchromen-2-one?
The IUPAC name of 6-chloro-4-[[(3,5-dimethyl-1,2-oxazol-4-yl)methyl-methylamino]methyl]-7-ethylchromen-2-one (CID 55680391) is 6-chloro-4-[[(3,5-dimethyl-1,2-oxazol-4-yl)methyl-methylamino]methyl]-7-ethylchromen-2-one.
What is the SMILES notation for 6-chloro-4-[[(3,5-dimethyl-1,2-oxazol-4-yl)methyl-methylamino]methyl]-7-ethylchromen-2-one?
The canonical SMILES for 6-chloro-4-[[(3,5-dimethyl-1,2-oxazol-4-yl)methyl-methylamino]methyl]-7-ethylchromen-2-one is CCc1cc2oc(=O)cc(CN(C)Cc3c(C)noc3C)c2cc1Cl.
What is the InChIKey of 6-chloro-4-[[(3,5-dimethyl-1,2-oxazol-4-yl)methyl-methylamino]methyl]-7-ethylchromen-2-one?
The InChIKey is RFNBZONZNWENLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21ClN2O3/c1-5-13-6-18-15(8-17(13)20)14(7-19(23)24-18)9-22(4)10-16-11(2)21-25-12(16)3/h6-8H,5,9-10H2,1-4H3.
What are the key properties of 6-chloro-4-[[(3,5-dimethyl-1,2-oxazol-4-yl)methyl-methylamino]methyl]-7-ethylchromen-2-one?
6-chloro-4-[[(3,5-dimethyl-1,2-oxazol-4-yl)methyl-methylamino]methyl]-7-ethylchromen-2-one has a molecular weight of 360.84 g/mol, XLogP of 4.25, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-4-[[(3,5-dimethyl-1,2-oxazol-4-yl)methyl-methylamino]methyl]-7-ethylchromen-2-one is sourced from PubChem (CID 55680391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).