C21H19Cl3N2O3 — CID 55351320
2-[(6-chloro-7-ethyl-2-oxochromen-4-yl)methyl-methylamino]-N-(2,6-dichlorophenyl)acetamide (PubChem CID 55351320) has the molecular formula C21H19Cl3N2O3 and a molecular weight of 453.75 g/mol. Its IUPAC name is 2-[(6-chloro-7-ethyl-2-oxochromen-4-yl)methyl-methylamino]-N-(2,6-dichlorophenyl)acetamide.
| Compound Name | 2-[(6-chloro-7-ethyl-2-oxochromen-4-yl)methyl-methylamino]-N-(2,6-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 55351320 |
| Molecular Formula | C21H19Cl3N2O3 |
| Molecular Weight | 453.75 g/mol |
| Exact Mass | 452.05 |
| IUPAC Name | 2-[(6-chloro-7-ethyl-2-oxochromen-4-yl)methyl-methylamino]-N-(2,6-dichlorophenyl)acetamide |
| SMILES | CCc1cc2oc(=O)cc(CN(C)CC(=O)Nc3c(Cl)cccc3Cl)c2cc1Cl |
| InChI | InChI=1S/C21H19Cl3N2O3/c1-3-12-7-18-14(9-17(12)24)13(8-20(28)29-18)10-26(2)11-19(27)25-21-15(22)5-4-6-16(21)23/h4-9H,3,10-11H2,1-2H3,(H,25,27) |
| InChIKey | LEYDPSLKBVTXFX-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.75 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|