C22H23Cl2NO2 — CID 3632309
4-[[(3,4-dichlorophenyl)methyl-methylamino]methyl]-7-methyl-6-propan-2-ylchromen-2-one (PubChem CID 3632309) has the molecular formula C22H23Cl2NO2 and a molecular weight of 404.34 g/mol. Its IUPAC name is 4-[[(3,4-dichlorophenyl)methyl-methylamino]methyl]-7-methyl-6-propan-2-ylchromen-2-one.
| Compound Name | 4-[[(3,4-dichlorophenyl)methyl-methylamino]methyl]-7-methyl-6-propan-2-ylchromen-2-one |
|---|---|
| PubChem CID | 3632309 |
| Molecular Formula | C22H23Cl2NO2 |
| Molecular Weight | 404.34 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 4-[[(3,4-dichlorophenyl)methyl-methylamino]methyl]-7-methyl-6-propan-2-ylchromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(CN(C)Cc3ccc(Cl)c(Cl)c3)c2cc1C(C)C |
| InChI | InChI=1S/C22H23Cl2NO2/c1-13(2)17-10-18-16(9-22(26)27-21(18)7-14(17)3)12-25(4)11-15-5-6-19(23)20(24)8-15/h5-10,13H,11-12H2,1-4H3 |
| InChIKey | UTZJGZYRMXACFC-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.34 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|