C24H30N4O2 — CID 86894760
7-methyl-4-[[methyl-[(1-pyridazin-3-ylpyrrolidin-2-yl)methyl]amino]methyl]-6-propan-2-ylchromen-2-one (PubChem CID 86894760) has the molecular formula C24H30N4O2 and a molecular weight of 406.53 g/mol. Its IUPAC name is 7-methyl-4-[[methyl-[(1-pyridazin-3-ylpyrrolidin-2-yl)methyl]amino]methyl]-6-propan-2-ylchromen-2-one.
| Compound Name | 7-methyl-4-[[methyl-[(1-pyridazin-3-ylpyrrolidin-2-yl)methyl]amino]methyl]-6-propan-2-ylchromen-2-one |
|---|---|
| PubChem CID | 86894760 |
| Molecular Formula | C24H30N4O2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 7-methyl-4-[[methyl-[(1-pyridazin-3-ylpyrrolidin-2-yl)methyl]amino]methyl]-6-propan-2-ylchromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(CN(C)CC3CCCN3c3cccnn3)c2cc1C(C)C |
| InChI | InChI=1S/C24H30N4O2/c1-16(2)20-13-21-18(12-24(29)30-22(21)11-17(20)3)14-27(4)15-19-7-6-10-28(19)23-8-5-9-25-26-23/h5,8-9,11-13,16,19H,6-7,10,14-15H2,1-4H3 |
| InChIKey | UIKSBTJFVIXQOI-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 62.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|