C21H19ClO5 — CID 8922777
(6-chloro-7-methyl-2-oxochromen-4-yl)methyl 2-(3,4-dimethylphenoxy)acetate (PubChem CID 8922777) has the molecular formula C21H19ClO5 and a molecular weight of 386.83 g/mol. Its IUPAC name is (6-chloro-7-methyl-2-oxochromen-4-yl)methyl 2-(3,4-dimethylphenoxy)acetate.
| Compound Name | (6-chloro-7-methyl-2-oxochromen-4-yl)methyl 2-(3,4-dimethylphenoxy)acetate |
|---|---|
| PubChem CID | 8922777 |
| Molecular Formula | C21H19ClO5 |
| Molecular Weight | 386.83 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | (6-chloro-7-methyl-2-oxochromen-4-yl)methyl 2-(3,4-dimethylphenoxy)acetate |
| SMILES | Cc1ccc(OCC(=O)OCc2cc(=O)oc3cc(C)c(Cl)cc23)cc1C |
| InChI | InChI=1S/C21H19ClO5/c1-12-4-5-16(6-13(12)2)25-11-21(24)26-10-15-8-20(23)27-19-7-14(3)18(22)9-17(15)19/h4-9H,10-11H2,1-3H3 |
| InChIKey | JPKMXEVTLDHMEX-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.83 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|