C15H15ClO5 — CID 8850704
(6-chloro-7-methyl-2-oxochromen-4-yl)methyl 2-ethoxyacetate (PubChem CID 8850704) has the molecular formula C15H15ClO5 and a molecular weight of 310.73 g/mol. Its IUPAC name is (6-chloro-7-methyl-2-oxochromen-4-yl)methyl 2-ethoxyacetate.
| Compound Name | (6-chloro-7-methyl-2-oxochromen-4-yl)methyl 2-ethoxyacetate |
|---|---|
| PubChem CID | 8850704 |
| Molecular Formula | C15H15ClO5 |
| Molecular Weight | 310.73 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | (6-chloro-7-methyl-2-oxochromen-4-yl)methyl 2-ethoxyacetate |
| SMILES | CCOCC(=O)OCc1cc(=O)oc2cc(C)c(Cl)cc12 |
| InChI | InChI=1S/C15H15ClO5/c1-3-19-8-15(18)20-7-10-5-14(17)21-13-4-9(2)12(16)6-11(10)13/h4-6H,3,7-8H2,1-2H3 |
| InChIKey | MFSPBHRPCFJDEU-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.73 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|