C20H20ClFNO2+ — CID 8744064
(6-chloro-7-methyl-2-oxochromen-4-yl)methyl-ethyl-[(3-fluorophenyl)methyl]azanium (PubChem CID 8744064) has the molecular formula C20H20ClFNO2+ and a molecular weight of 360.84 g/mol. Its IUPAC name is (6-chloro-7-methyl-2-oxochromen-4-yl)methyl-ethyl-[(3-fluorophenyl)methyl]azanium.
| Compound Name | (6-chloro-7-methyl-2-oxochromen-4-yl)methyl-ethyl-[(3-fluorophenyl)methyl]azanium |
|---|---|
| PubChem CID | 8744064 |
| Molecular Formula | C20H20ClFNO2+ |
| Molecular Weight | 360.84 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | (6-chloro-7-methyl-2-oxochromen-4-yl)methyl-ethyl-[(3-fluorophenyl)methyl]azanium |
| SMILES | CC[NH+](Cc1cccc(F)c1)Cc1cc(=O)oc2cc(C)c(Cl)cc12 |
| InChI | InChI=1S/C20H19ClFNO2/c1-3-23(11-14-5-4-6-16(22)8-14)12-15-9-20(24)25-19-7-13(2)18(21)10-17(15)19/h4-10H,3,11-12H2,1-2H3/p+1 |
| InChIKey | LWDAUJCRXNFVJA-UHFFFAOYSA-O |
| XLogP | 3.50 |
| TPSA | 34.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.84 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|