C19H17ClFNO2 — CID 4806215
6-chloro-4-[[1-(4-fluorophenyl)ethylamino]methyl]-7-methylchromen-2-one (PubChem CID 4806215) has the molecular formula C19H17ClFNO2 and a molecular weight of 345.80 g/mol. Its IUPAC name is 6-chloro-4-[[1-(4-fluorophenyl)ethylamino]methyl]-7-methylchromen-2-one.
| Compound Name | 6-chloro-4-[[1-(4-fluorophenyl)ethylamino]methyl]-7-methylchromen-2-one |
|---|---|
| PubChem CID | 4806215 |
| Molecular Formula | C19H17ClFNO2 |
| Molecular Weight | 345.80 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 6-chloro-4-[[1-(4-fluorophenyl)ethylamino]methyl]-7-methylchromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(CNC(C)c3ccc(F)cc3)c2cc1Cl |
| InChI | InChI=1S/C19H17ClFNO2/c1-11-7-18-16(9-17(11)20)14(8-19(23)24-18)10-22-12(2)13-3-5-15(21)6-4-13/h3-9,12,22H,10H2,1-2H3 |
| InChIKey | AJNWIIUUXAXMFX-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.80 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|