C19H22NO2S+ — CID 8718620
(6,7-dimethyl-2-oxochromen-4-yl)methyl-ethyl-(thiophen-2-ylmethyl)azanium (PubChem CID 8718620) has the molecular formula C19H22NO2S+ and a molecular weight of 328.46 g/mol. Its IUPAC name is (6,7-dimethyl-2-oxochromen-4-yl)methyl-ethyl-(thiophen-2-ylmethyl)azanium.
| Compound Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl-ethyl-(thiophen-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 8718620 |
| Molecular Formula | C19H22NO2S+ |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl-ethyl-(thiophen-2-ylmethyl)azanium |
| SMILES | CC[NH+](Cc1cccs1)Cc1cc(=O)oc2cc(C)c(C)cc12 |
| InChI | InChI=1S/C19H21NO2S/c1-4-20(12-16-6-5-7-23-16)11-15-10-19(21)22-18-9-14(3)13(2)8-17(15)18/h5-10H,4,11-12H2,1-3H3/p+1 |
| InChIKey | PBKBTAZYNMCMRZ-UHFFFAOYSA-O |
| XLogP | 3.08 |
| TPSA | 34.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|