C24H28N2O4+2 — CID 2045079
4-[[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1,4-diium-1-yl]methyl]-7,8-dimethylchromen-2-one (PubChem CID 2045079) has the molecular formula C24H28N2O4+2 and a molecular weight of 408.50 g/mol. Its IUPAC name is 4-[[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1,4-diium-1-yl]methyl]-7,8-dimethylchromen-2-one.
| Compound Name | 4-[[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1,4-diium-1-yl]methyl]-7,8-dimethylchromen-2-one |
|---|---|
| PubChem CID | 2045079 |
| Molecular Formula | C24H28N2O4+2 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 4-[[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1,4-diium-1-yl]methyl]-7,8-dimethylchromen-2-one |
| SMILES | Cc1ccc2c(C[NH+]3CC[NH+](Cc4ccc5c(c4)OCO5)CC3)cc(=O)oc2c1C |
| InChI | InChI=1S/C24H26N2O4/c1-16-3-5-20-19(12-23(27)30-24(20)17(16)2)14-26-9-7-25(8-10-26)13-18-4-6-21-22(11-18)29-15-28-21/h3-6,11-12H,7-10,13-15H2,1-2H3/p+2 |
| InChIKey | GILNENKPNRBYRD-UHFFFAOYSA-P |
| XLogP | 0.62 |
| TPSA | 57.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|