C19H16O4S — CID 2606718
4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanylmethyl)-7-methylchromen-2-one (PubChem CID 2606718) has the molecular formula C19H16O4S and a molecular weight of 340.40 g/mol. Its IUPAC name is 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanylmethyl)-7-methylchromen-2-one.
| Compound Name | 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanylmethyl)-7-methylchromen-2-one |
|---|---|
| PubChem CID | 2606718 |
| Molecular Formula | C19H16O4S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanylmethyl)-7-methylchromen-2-one |
| SMILES | Cc1ccc2c(CSc3ccc4c(c3)OCCO4)cc(=O)oc2c1 |
| InChI | InChI=1S/C19H16O4S/c1-12-2-4-15-13(9-19(20)23-17(15)8-12)11-24-14-3-5-16-18(10-14)22-7-6-21-16/h2-5,8-10H,6-7,11H2,1H3 |
| InChIKey | OMAGVWVVAOUPPQ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|