C18H12ClNO3S — CID 52888099
4-[(5-chloro-1,3-benzoxazol-2-yl)sulfanylmethyl]-7-methylchromen-2-one (PubChem CID 52888099) has the molecular formula C18H12ClNO3S and a molecular weight of 357.82 g/mol. Its IUPAC name is 4-[(5-chloro-1,3-benzoxazol-2-yl)sulfanylmethyl]-7-methylchromen-2-one.
| Compound Name | 4-[(5-chloro-1,3-benzoxazol-2-yl)sulfanylmethyl]-7-methylchromen-2-one |
|---|---|
| PubChem CID | 52888099 |
| Molecular Formula | C18H12ClNO3S |
| Molecular Weight | 357.82 g/mol |
| Exact Mass | 357.02 |
| IUPAC Name | 4-[(5-chloro-1,3-benzoxazol-2-yl)sulfanylmethyl]-7-methylchromen-2-one |
| SMILES | Cc1ccc2c(CSc3nc4cc(Cl)ccc4o3)cc(=O)oc2c1 |
| InChI | InChI=1S/C18H12ClNO3S/c1-10-2-4-13-11(7-17(21)22-16(13)6-10)9-24-18-20-14-8-12(19)3-5-15(14)23-18/h2-8H,9H2,1H3 |
| InChIKey | VSCLGKQGLWWZNZ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 56.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.82 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|