C13H12N4O2S — CID 2628634
4-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-7-methylchromen-2-one (PubChem CID 2628634) has the molecular formula C13H12N4O2S and a molecular weight of 288.33 g/mol. Its IUPAC name is 4-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-7-methylchromen-2-one.
| Compound Name | 4-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-7-methylchromen-2-one |
|---|---|
| PubChem CID | 2628634 |
| Molecular Formula | C13H12N4O2S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 4-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-7-methylchromen-2-one |
| SMILES | Cc1ccc2c(CSc3n[nH]c(N)n3)cc(=O)oc2c1 |
| InChI | InChI=1S/C13H12N4O2S/c1-7-2-3-9-8(5-11(18)19-10(9)4-7)6-20-13-15-12(14)16-17-13/h2-5H,6H2,1H3,(H3,14,15,16,17) |
| InChIKey | NYNFVEGUXMOPJN-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 97.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|