C14H11BrN4O2S — CID 78765403
7-bromo-4-[(4,6-diaminopyrimidin-2-yl)sulfanylmethyl]chromen-2-one (PubChem CID 78765403) has the molecular formula C14H11BrN4O2S and a molecular weight of 379.24 g/mol. Its IUPAC name is 7-bromo-4-[(4,6-diaminopyrimidin-2-yl)sulfanylmethyl]chromen-2-one.
| Compound Name | 7-bromo-4-[(4,6-diaminopyrimidin-2-yl)sulfanylmethyl]chromen-2-one |
|---|---|
| PubChem CID | 78765403 |
| Molecular Formula | C14H11BrN4O2S |
| Molecular Weight | 379.24 g/mol |
| Exact Mass | 377.98 |
| IUPAC Name | 7-bromo-4-[(4,6-diaminopyrimidin-2-yl)sulfanylmethyl]chromen-2-one |
| SMILES | Nc1cc(N)nc(SCc2cc(=O)oc3cc(Br)ccc23)n1 |
| InChI | InChI=1S/C14H11BrN4O2S/c15-8-1-2-9-7(3-13(20)21-10(9)4-8)6-22-14-18-11(16)5-12(17)19-14/h1-5H,6H2,(H4,16,17,18,19) |
| InChIKey | SHACXHSPKJGWMQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 108.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.24 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|