C19H21BrN2O2S — CID 29486584
7-bromo-4-[[4,5-dimethyl-1-(2-methylpropyl)imidazol-2-yl]sulfanylmethyl]chromen-2-one (PubChem CID 29486584) has the molecular formula C19H21BrN2O2S and a molecular weight of 421.36 g/mol. Its IUPAC name is 7-bromo-4-[[4,5-dimethyl-1-(2-methylpropyl)imidazol-2-yl]sulfanylmethyl]chromen-2-one.
| Compound Name | 7-bromo-4-[[4,5-dimethyl-1-(2-methylpropyl)imidazol-2-yl]sulfanylmethyl]chromen-2-one |
|---|---|
| PubChem CID | 29486584 |
| Molecular Formula | C19H21BrN2O2S |
| Molecular Weight | 421.36 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | 7-bromo-4-[[4,5-dimethyl-1-(2-methylpropyl)imidazol-2-yl]sulfanylmethyl]chromen-2-one |
| SMILES | Cc1nc(SCc2cc(=O)oc3cc(Br)ccc23)n(CC(C)C)c1C |
| InChI | InChI=1S/C19H21BrN2O2S/c1-11(2)9-22-13(4)12(3)21-19(22)25-10-14-7-18(23)24-17-8-15(20)5-6-16(14)17/h5-8,11H,9-10H2,1-4H3 |
| InChIKey | UALSJBGCDDNFHV-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.36 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|