C21H26N2O2S — CID 40518431
4-[[4,5-dimethyl-1-(2-methylpropyl)imidazol-2-yl]sulfanylmethyl]-6,7-dimethylchromen-2-one (PubChem CID 40518431) has the molecular formula C21H26N2O2S and a molecular weight of 370.52 g/mol. Its IUPAC name is 4-[[4,5-dimethyl-1-(2-methylpropyl)imidazol-2-yl]sulfanylmethyl]-6,7-dimethylchromen-2-one.
| Compound Name | 4-[[4,5-dimethyl-1-(2-methylpropyl)imidazol-2-yl]sulfanylmethyl]-6,7-dimethylchromen-2-one |
|---|---|
| PubChem CID | 40518431 |
| Molecular Formula | C21H26N2O2S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 4-[[4,5-dimethyl-1-(2-methylpropyl)imidazol-2-yl]sulfanylmethyl]-6,7-dimethylchromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(CSc3nc(C)c(C)n3CC(C)C)c2cc1C |
| InChI | InChI=1S/C21H26N2O2S/c1-12(2)10-23-16(6)15(5)22-21(23)26-11-17-9-20(24)25-19-8-14(4)13(3)7-18(17)19/h7-9,12H,10-11H2,1-6H3 |
| InChIKey | IJCZIEBIRBJTDJ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|