C14H13N3O2S — CID 7785053
6,7-dimethyl-4-(1H-1,2,4-triazol-5-ylsulfanylmethyl)chromen-2-one (PubChem CID 7785053) has the molecular formula C14H13N3O2S and a molecular weight of 287.34 g/mol. Its IUPAC name is 6,7-dimethyl-4-(1H-1,2,4-triazol-5-ylsulfanylmethyl)chromen-2-one.
| Compound Name | 6,7-dimethyl-4-(1H-1,2,4-triazol-5-ylsulfanylmethyl)chromen-2-one |
|---|---|
| PubChem CID | 7785053 |
| Molecular Formula | C14H13N3O2S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 6,7-dimethyl-4-(1H-1,2,4-triazol-5-ylsulfanylmethyl)chromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(CSc3ncn[nH]3)c2cc1C |
| InChI | InChI=1S/C14H13N3O2S/c1-8-3-11-10(6-20-14-15-7-16-17-14)5-13(18)19-12(11)4-9(8)2/h3-5,7H,6H2,1-2H3,(H,15,16,17) |
| InChIKey | ZYZCRRSSZLDEOB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|