C21H18N2O3S — CID 7826422
6,7-dimethyl-4-[[5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]chromen-2-one (PubChem CID 7826422) has the molecular formula C21H18N2O3S and a molecular weight of 378.45 g/mol. Its IUPAC name is 6,7-dimethyl-4-[[5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]chromen-2-one.
| Compound Name | 6,7-dimethyl-4-[[5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]chromen-2-one |
|---|---|
| PubChem CID | 7826422 |
| Molecular Formula | C21H18N2O3S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 6,7-dimethyl-4-[[5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]chromen-2-one |
| SMILES | Cc1cccc(-c2nnc(SCc3cc(=O)oc4cc(C)c(C)cc34)o2)c1 |
| InChI | InChI=1S/C21H18N2O3S/c1-12-5-4-6-15(7-12)20-22-23-21(26-20)27-11-16-10-19(24)25-18-9-14(3)13(2)8-17(16)18/h4-10H,11H2,1-3H3 |
| InChIKey | DQLVLJBJZOPRHE-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 69.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|