C21H19N3O2S2 — CID 7863181
6,7-dimethyl-4-[[5-(3-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]chromen-2-one (PubChem CID 7863181) has the molecular formula C21H19N3O2S2 and a molecular weight of 409.54 g/mol. Its IUPAC name is 6,7-dimethyl-4-[[5-(3-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]chromen-2-one.
| Compound Name | 6,7-dimethyl-4-[[5-(3-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]chromen-2-one |
|---|---|
| PubChem CID | 7863181 |
| Molecular Formula | C21H19N3O2S2 |
| Molecular Weight | 409.54 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | 6,7-dimethyl-4-[[5-(3-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]chromen-2-one |
| SMILES | Cc1cccc(Nc2nnc(SCc3cc(=O)oc4cc(C)c(C)cc34)s2)c1 |
| InChI | InChI=1S/C21H19N3O2S2/c1-12-5-4-6-16(7-12)22-20-23-24-21(28-20)27-11-15-10-19(25)26-18-9-14(3)13(2)8-17(15)18/h4-10H,11H2,1-3H3,(H,22,23) |
| InChIKey | KWZFIEQRPNDKGQ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.54 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|