C23H17N3O3S2 — CID 3401912
1-[[5-(4-methoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]benzo[f]chromen-3-one (PubChem CID 3401912) has the molecular formula C23H17N3O3S2 and a molecular weight of 447.54 g/mol. Its IUPAC name is 1-[[5-(4-methoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]benzo[f]chromen-3-one.
| Compound Name | 1-[[5-(4-methoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]benzo[f]chromen-3-one |
|---|---|
| PubChem CID | 3401912 |
| Molecular Formula | C23H17N3O3S2 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.07 |
| IUPAC Name | 1-[[5-(4-methoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]benzo[f]chromen-3-one |
| SMILES | COc1ccc(Nc2nnc(SCc3cc(=O)oc4ccc5ccccc5c34)s2)cc1 |
| InChI | InChI=1S/C23H17N3O3S2/c1-28-17-9-7-16(8-10-17)24-22-25-26-23(31-22)30-13-15-12-20(27)29-19-11-6-14-4-2-3-5-18(14)21(15)19/h2-12H,13H2,1H3,(H,24,25) |
| InChIKey | DXFWZQVDWZPCDM-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|