C21H19N3O3S2 — CID 4858605
7-ethyl-4-[[5-(4-methoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]chromen-2-one (PubChem CID 4858605) has the molecular formula C21H19N3O3S2 and a molecular weight of 425.54 g/mol. Its IUPAC name is 7-ethyl-4-[[5-(4-methoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]chromen-2-one.
| Compound Name | 7-ethyl-4-[[5-(4-methoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]chromen-2-one |
|---|---|
| PubChem CID | 4858605 |
| Molecular Formula | C21H19N3O3S2 |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | 7-ethyl-4-[[5-(4-methoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]chromen-2-one |
| SMILES | CCc1ccc2c(CSc3nnc(Nc4ccc(OC)cc4)s3)cc(=O)oc2c1 |
| InChI | InChI=1S/C21H19N3O3S2/c1-3-13-4-9-17-14(11-19(25)27-18(17)10-13)12-28-21-24-23-20(29-21)22-15-5-7-16(26-2)8-6-15/h4-11H,3,12H2,1-2H3,(H,22,23) |
| InChIKey | JEAMOTHSWFYVHT-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|