C21H17FN4O4S2 — CID 2475918
ethyl N-[4-[[5-(2-fluoroanilino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-2-oxochromen-7-yl]carbamate (PubChem CID 2475918) has the molecular formula C21H17FN4O4S2 and a molecular weight of 472.52 g/mol. Its IUPAC name is ethyl N-[4-[[5-(2-fluoroanilino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-2-oxochromen-7-yl]carbamate.
| Compound Name | ethyl N-[4-[[5-(2-fluoroanilino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-2-oxochromen-7-yl]carbamate |
|---|---|
| PubChem CID | 2475918 |
| Molecular Formula | C21H17FN4O4S2 |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.07 |
| IUPAC Name | ethyl N-[4-[[5-(2-fluoroanilino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-2-oxochromen-7-yl]carbamate |
| SMILES | CCOC(=O)Nc1ccc2c(CSc3nnc(Nc4ccccc4F)s3)cc(=O)oc2c1 |
| InChI | InChI=1S/C21H17FN4O4S2/c1-2-29-20(28)23-13-7-8-14-12(9-18(27)30-17(14)10-13)11-31-21-26-25-19(32-21)24-16-6-4-3-5-15(16)22/h3-10H,2,11H2,1H3,(H,23,28)(H,24,25) |
| InChIKey | UBXRWDMGYBNLEP-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|