C24H25N3O3S2 — CID 4284450
4-[[5-(2-ethoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-7-methyl-6-propan-2-ylchromen-2-one (PubChem CID 4284450) has the molecular formula C24H25N3O3S2 and a molecular weight of 467.62 g/mol. Its IUPAC name is 4-[[5-(2-ethoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-7-methyl-6-propan-2-ylchromen-2-one.
| Compound Name | 4-[[5-(2-ethoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-7-methyl-6-propan-2-ylchromen-2-one |
|---|---|
| PubChem CID | 4284450 |
| Molecular Formula | C24H25N3O3S2 |
| Molecular Weight | 467.62 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | 4-[[5-(2-ethoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-7-methyl-6-propan-2-ylchromen-2-one |
| SMILES | CCOc1ccccc1Nc1nnc(SCc2cc(=O)oc3cc(C)c(C(C)C)cc23)s1 |
| InChI | InChI=1S/C24H25N3O3S2/c1-5-29-20-9-7-6-8-19(20)25-23-26-27-24(32-23)31-13-16-11-22(28)30-21-10-15(4)17(14(2)3)12-18(16)21/h6-12,14H,5,13H2,1-4H3,(H,25,26) |
| InChIKey | OZXXRQULSZQWHE-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.62 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|