C18H17N5O4S2 — CID 27322311
4-[[5-(2-ethoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-3-nitrobenzamide (PubChem CID 27322311) has the molecular formula C18H17N5O4S2 and a molecular weight of 431.50 g/mol. Its IUPAC name is 4-[[5-(2-ethoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-3-nitrobenzamide.
| Compound Name | 4-[[5-(2-ethoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 27322311 |
| Molecular Formula | C18H17N5O4S2 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | 4-[[5-(2-ethoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-3-nitrobenzamide |
| SMILES | CCOc1ccccc1Nc1nnc(SCc2ccc(C(N)=O)cc2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C18H17N5O4S2/c1-2-27-15-6-4-3-5-13(15)20-17-21-22-18(29-17)28-10-12-8-7-11(16(19)24)9-14(12)23(25)26/h3-9H,2,10H2,1H3,(H2,19,24)(H,20,21) |
| InChIKey | PLMARVYZVUJREH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|