C20H19N5O5S2 — CID 40832417
N-[5-[2-(2-ethoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-4-methyl-3-nitrobenzamide (PubChem CID 40832417) has the molecular formula C20H19N5O5S2 and a molecular weight of 473.54 g/mol. Its IUPAC name is N-[5-[2-(2-ethoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-4-methyl-3-nitrobenzamide.
| Compound Name | N-[5-[2-(2-ethoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-4-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 40832417 |
| Molecular Formula | C20H19N5O5S2 |
| Molecular Weight | 473.54 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | N-[5-[2-(2-ethoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-4-methyl-3-nitrobenzamide |
| SMILES | CCOc1ccccc1NC(=O)CSc1nnc(NC(=O)c2ccc(C)c([N+](=O)[O-])c2)s1 |
| InChI | InChI=1S/C20H19N5O5S2/c1-3-30-16-7-5-4-6-14(16)21-17(26)11-31-20-24-23-19(32-20)22-18(27)13-9-8-12(2)15(10-13)25(28)29/h4-10H,3,11H2,1-2H3,(H,21,26)(H,22,23,27) |
| InChIKey | IKXLAZPYMRHKCP-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 136.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.54 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|