C20H19N5O4S2 — CID 23969400
N-[5-[2-(2,5-dimethylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-4-methyl-3-nitrobenzamide (PubChem CID 23969400) has the molecular formula C20H19N5O4S2 and a molecular weight of 457.54 g/mol. Its IUPAC name is N-[5-[2-(2,5-dimethylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-4-methyl-3-nitrobenzamide.
| Compound Name | N-[5-[2-(2,5-dimethylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-4-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 23969400 |
| Molecular Formula | C20H19N5O4S2 |
| Molecular Weight | 457.54 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | N-[5-[2-(2,5-dimethylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-4-methyl-3-nitrobenzamide |
| SMILES | Cc1ccc(C)c(NC(=O)CSc2nnc(NC(=O)c3ccc(C)c([N+](=O)[O-])c3)s2)c1 |
| InChI | InChI=1S/C20H19N5O4S2/c1-11-4-5-12(2)15(8-11)21-17(26)10-30-20-24-23-19(31-20)22-18(27)14-7-6-13(3)16(9-14)25(28)29/h4-9H,10H2,1-3H3,(H,21,26)(H,22,23,27) |
| InChIKey | FKKFNBMWCYGZBL-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 127.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.54 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|