C20H21N5O5S2 — CID 2371507
(2R)-2-[[5-(2-ethoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-methoxy-5-nitrophenyl)propanamide (PubChem CID 2371507) has the molecular formula C20H21N5O5S2 and a molecular weight of 475.55 g/mol. Its IUPAC name is (2R)-2-[[5-(2-ethoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-methoxy-5-nitrophenyl)propanamide.
| Compound Name | (2R)-2-[[5-(2-ethoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-methoxy-5-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 2371507 |
| Molecular Formula | C20H21N5O5S2 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | (2R)-2-[[5-(2-ethoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-methoxy-5-nitrophenyl)propanamide |
| SMILES | CCOc1ccccc1Nc1nnc(S[C@H](C)C(=O)Nc2cc([N+](=O)[O-])ccc2OC)s1 |
| InChI | InChI=1S/C20H21N5O5S2/c1-4-30-17-8-6-5-7-14(17)22-19-23-24-20(32-19)31-12(2)18(26)21-15-11-13(25(27)28)9-10-16(15)29-3/h5-12H,4H2,1-3H3,(H,21,26)(H,22,23)/t12-/m1/s1 |
| InChIKey | HSJIYEFAJAEARR-GFCCVEGCSA-N |
| XLogP | 4.72 |
| TPSA | 128.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|