C19H18ClN5O4S2 — CID 24519395
2-[[5-(3-chloro-4-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-methoxy-5-nitrophenyl)propanamide (PubChem CID 24519395) has the molecular formula C19H18ClN5O4S2 and a molecular weight of 479.97 g/mol. Its IUPAC name is 2-[[5-(3-chloro-4-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-methoxy-5-nitrophenyl)propanamide.
| Compound Name | 2-[[5-(3-chloro-4-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-methoxy-5-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 24519395 |
| Molecular Formula | C19H18ClN5O4S2 |
| Molecular Weight | 479.97 g/mol |
| Exact Mass | 479.05 |
| IUPAC Name | 2-[[5-(3-chloro-4-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-methoxy-5-nitrophenyl)propanamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)C(C)Sc1nnc(Nc2ccc(C)c(Cl)c2)s1 |
| InChI | InChI=1S/C19H18ClN5O4S2/c1-10-4-5-12(8-14(10)20)21-18-23-24-19(31-18)30-11(2)17(26)22-15-9-13(25(27)28)6-7-16(15)29-3/h4-9,11H,1-3H3,(H,21,23)(H,22,26) |
| InChIKey | JXRXPHXCRFNDQB-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.97 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|