C19H22N4O4S2 — CID 16576021
N-[4-[[5-(3-ethoxypropylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-2-oxochromen-7-yl]acetamide (PubChem CID 16576021) has the molecular formula C19H22N4O4S2 and a molecular weight of 434.54 g/mol. Its IUPAC name is N-[4-[[5-(3-ethoxypropylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-2-oxochromen-7-yl]acetamide.
| Compound Name | N-[4-[[5-(3-ethoxypropylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-2-oxochromen-7-yl]acetamide |
|---|---|
| PubChem CID | 16576021 |
| Molecular Formula | C19H22N4O4S2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | N-[4-[[5-(3-ethoxypropylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-2-oxochromen-7-yl]acetamide |
| SMILES | CCOCCCNc1nnc(SCc2cc(=O)oc3cc(NC(C)=O)ccc23)s1 |
| InChI | InChI=1S/C19H22N4O4S2/c1-3-26-8-4-7-20-18-22-23-19(29-18)28-11-13-9-17(25)27-16-10-14(21-12(2)24)5-6-15(13)16/h5-6,9-10H,3-4,7-8,11H2,1-2H3,(H,20,22)(H,21,24) |
| InChIKey | SVBYZVRPCMGLQU-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|