C19H15N3O3S2 — CID 9327268
4-[[5-(benzylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-7-hydroxychromen-2-one (PubChem CID 9327268) has the molecular formula C19H15N3O3S2 and a molecular weight of 397.48 g/mol. Its IUPAC name is 4-[[5-(benzylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-7-hydroxychromen-2-one.
| Compound Name | 4-[[5-(benzylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-7-hydroxychromen-2-one |
|---|---|
| PubChem CID | 9327268 |
| Molecular Formula | C19H15N3O3S2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | 4-[[5-(benzylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-7-hydroxychromen-2-one |
| SMILES | O=c1cc(CSc2nnc(NCc3ccccc3)s2)c2ccc(O)cc2o1 |
| InChI | InChI=1S/C19H15N3O3S2/c23-14-6-7-15-13(8-17(24)25-16(15)9-14)11-26-19-22-21-18(27-19)20-10-12-4-2-1-3-5-12/h1-9,23H,10-11H2,(H,20,21) |
| InChIKey | KVNGBTFSFBXSON-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|