C13H10N2O3S2 — CID 43249764
4-[(2-amino-1,3-thiazol-5-yl)sulfanylmethyl]-7-hydroxychromen-2-one (PubChem CID 43249764) has the molecular formula C13H10N2O3S2 and a molecular weight of 306.37 g/mol. Its IUPAC name is 4-[(2-amino-1,3-thiazol-5-yl)sulfanylmethyl]-7-hydroxychromen-2-one.
| Compound Name | 4-[(2-amino-1,3-thiazol-5-yl)sulfanylmethyl]-7-hydroxychromen-2-one |
|---|---|
| PubChem CID | 43249764 |
| Molecular Formula | C13H10N2O3S2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | 4-[(2-amino-1,3-thiazol-5-yl)sulfanylmethyl]-7-hydroxychromen-2-one |
| SMILES | Nc1ncc(SCc2cc(=O)oc3cc(O)ccc23)s1 |
| InChI | InChI=1S/C13H10N2O3S2/c14-13-15-5-12(20-13)19-6-7-3-11(17)18-10-4-8(16)1-2-9(7)10/h1-5,16H,6H2,(H2,14,15) |
| InChIKey | NVVQIRFUISRTII-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|