C13H11N3O3S — CID 7866692
7-hydroxy-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]chromen-2-one (PubChem CID 7866692) has the molecular formula C13H11N3O3S and a molecular weight of 289.32 g/mol. Its IUPAC name is 7-hydroxy-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]chromen-2-one.
| Compound Name | 7-hydroxy-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]chromen-2-one |
|---|---|
| PubChem CID | 7866692 |
| Molecular Formula | C13H11N3O3S |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 7-hydroxy-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]chromen-2-one |
| SMILES | Cn1cnnc1SCc1cc(=O)oc2cc(O)ccc12 |
| InChI | InChI=1S/C13H11N3O3S/c1-16-7-14-15-13(16)20-6-8-4-12(18)19-11-5-9(17)2-3-10(8)11/h2-5,7,17H,6H2,1H3 |
| InChIKey | RUCAXZVFWULBCE-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|