C19H20N4O4S2 — CID 16570793
N-[2-oxo-4-[[5-(oxolan-2-ylmethylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]chromen-7-yl]acetamide (PubChem CID 16570793) has the molecular formula C19H20N4O4S2 and a molecular weight of 432.53 g/mol. Its IUPAC name is N-[2-oxo-4-[[5-(oxolan-2-ylmethylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]chromen-7-yl]acetamide.
| Compound Name | N-[2-oxo-4-[[5-(oxolan-2-ylmethylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]chromen-7-yl]acetamide |
|---|---|
| PubChem CID | 16570793 |
| Molecular Formula | C19H20N4O4S2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | N-[2-oxo-4-[[5-(oxolan-2-ylmethylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]chromen-7-yl]acetamide |
| SMILES | CC(=O)Nc1ccc2c(CSc3nnc(NCC4CCCO4)s3)cc(=O)oc2c1 |
| InChI | InChI=1S/C19H20N4O4S2/c1-11(24)21-13-4-5-15-12(7-17(25)27-16(15)8-13)10-28-19-23-22-18(29-19)20-9-14-3-2-6-26-14/h4-5,7-8,14H,2-3,6,9-10H2,1H3,(H,20,22)(H,21,24) |
| InChIKey | IJAHVGRXIZPALD-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|