C17H12N2O2S3 — CID 2669083
1-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]benzo[f]chromen-3-one (PubChem CID 2669083) has the molecular formula C17H12N2O2S3 and a molecular weight of 372.50 g/mol. Its IUPAC name is 1-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]benzo[f]chromen-3-one.
| Compound Name | 1-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]benzo[f]chromen-3-one |
|---|---|
| PubChem CID | 2669083 |
| Molecular Formula | C17H12N2O2S3 |
| Molecular Weight | 372.50 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | 1-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]benzo[f]chromen-3-one |
| SMILES | CSc1nnc(SCc2cc(=O)oc3ccc4ccccc4c23)s1 |
| InChI | InChI=1S/C17H12N2O2S3/c1-22-16-18-19-17(24-16)23-9-11-8-14(20)21-13-7-6-10-4-2-3-5-12(10)15(11)13/h2-8H,9H2,1H3 |
| InChIKey | QQCYZTXKDIAIDP-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.50 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|