C23H17N3O2S — CID 7818101
1-[[5-(4-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]benzo[f]chromen-3-one (PubChem CID 7818101) has the molecular formula C23H17N3O2S and a molecular weight of 399.48 g/mol. Its IUPAC name is 1-[[5-(4-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]benzo[f]chromen-3-one.
| Compound Name | 1-[[5-(4-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]benzo[f]chromen-3-one |
|---|---|
| PubChem CID | 7818101 |
| Molecular Formula | C23H17N3O2S |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | 1-[[5-(4-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]benzo[f]chromen-3-one |
| SMILES | Cc1ccc(-c2nc(SCc3cc(=O)oc4ccc5ccccc5c34)n[nH]2)cc1 |
| InChI | InChI=1S/C23H17N3O2S/c1-14-6-8-16(9-7-14)22-24-23(26-25-22)29-13-17-12-20(27)28-19-11-10-15-4-2-3-5-18(15)21(17)19/h2-12H,13H2,1H3,(H,24,25,26) |
| InChIKey | WJSMWAWQLJNVIH-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|