C21H14N4O2S — CID 4823316
1-[(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]benzo[f]chromen-3-one (PubChem CID 4823316) has the molecular formula C21H14N4O2S and a molecular weight of 386.44 g/mol. Its IUPAC name is 1-[(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]benzo[f]chromen-3-one.
| Compound Name | 1-[(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]benzo[f]chromen-3-one |
|---|---|
| PubChem CID | 4823316 |
| Molecular Formula | C21H14N4O2S |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 1-[(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]benzo[f]chromen-3-one |
| SMILES | O=c1cc(CSc2n[nH]c(-c3ccncc3)n2)c2c(ccc3ccccc32)o1 |
| InChI | InChI=1S/C21H14N4O2S/c26-18-11-15(19-16-4-2-1-3-13(16)5-6-17(19)27-18)12-28-21-23-20(24-25-21)14-7-9-22-10-8-14/h1-11H,12H2,(H,23,24,25) |
| InChIKey | ZTJPBLDBKXBGOX-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|