C19H16N4O2S — CID 7723371
7-ethyl-4-[(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]chromen-2-one (PubChem CID 7723371) has the molecular formula C19H16N4O2S and a molecular weight of 364.43 g/mol. Its IUPAC name is 7-ethyl-4-[(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]chromen-2-one.
| Compound Name | 7-ethyl-4-[(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]chromen-2-one |
|---|---|
| PubChem CID | 7723371 |
| Molecular Formula | C19H16N4O2S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 7-ethyl-4-[(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]chromen-2-one |
| SMILES | CCc1ccc2c(CSc3n[nH]c(-c4ccncc4)n3)cc(=O)oc2c1 |
| InChI | InChI=1S/C19H16N4O2S/c1-2-12-3-4-15-14(10-17(24)25-16(15)9-12)11-26-19-21-18(22-23-19)13-5-7-20-8-6-13/h3-10H,2,11H2,1H3,(H,21,22,23) |
| InChIKey | BFPIRFRYGVGYFD-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|