C19H14N2O3S — CID 2107287
7-methyl-4-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]chromen-2-one (PubChem CID 2107287) has the molecular formula C19H14N2O3S and a molecular weight of 350.40 g/mol. Its IUPAC name is 7-methyl-4-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]chromen-2-one.
| Compound Name | 7-methyl-4-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]chromen-2-one |
|---|---|
| PubChem CID | 2107287 |
| Molecular Formula | C19H14N2O3S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | 7-methyl-4-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]chromen-2-one |
| SMILES | Cc1ccc2c(CSc3nnc(-c4ccccc4)o3)cc(=O)oc2c1 |
| InChI | InChI=1S/C19H14N2O3S/c1-12-7-8-15-14(10-17(22)23-16(15)9-12)11-25-19-21-20-18(24-19)13-5-3-2-4-6-13/h2-10H,11H2,1H3 |
| InChIKey | CADADRMWHWQVTA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 69.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|