C15H18O4S — CID 97069657
4-[[(2R)-2,3-dihydroxypropyl]sulfanylmethyl]-6,7-dimethylchromen-2-one (PubChem CID 97069657) has the molecular formula C15H18O4S and a molecular weight of 294.37 g/mol. Its IUPAC name is 4-[[(2R)-2,3-dihydroxypropyl]sulfanylmethyl]-6,7-dimethylchromen-2-one.
| Compound Name | 4-[[(2R)-2,3-dihydroxypropyl]sulfanylmethyl]-6,7-dimethylchromen-2-one |
|---|---|
| PubChem CID | 97069657 |
| Molecular Formula | C15H18O4S |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 4-[[(2R)-2,3-dihydroxypropyl]sulfanylmethyl]-6,7-dimethylchromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(CSC[C@H](O)CO)c2cc1C |
| InChI | InChI=1S/C15H18O4S/c1-9-3-13-11(7-20-8-12(17)6-16)5-15(18)19-14(13)4-10(9)2/h3-5,12,16-17H,6-8H2,1-2H3/t12-/m1/s1 |
| InChIKey | GNCWQZRDVJEEPX-GFCCVEGCSA-N |
| XLogP | 2.00 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|