C15H18N2O2S — CID 8774951
(6,7-dimethyl-2-oxochromen-4-yl)methyl N'-ethylcarbamimidothioate (PubChem CID 8774951) has the molecular formula C15H18N2O2S and a molecular weight of 290.39 g/mol. Its IUPAC name is (6,7-dimethyl-2-oxochromen-4-yl)methyl N'-ethylcarbamimidothioate.
| Compound Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl N'-ethylcarbamimidothioate |
|---|---|
| PubChem CID | 8774951 |
| Molecular Formula | C15H18N2O2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl N'-ethylcarbamimidothioate |
| SMILES | CC/N=C(\N)SCc1cc(=O)oc2cc(C)c(C)cc12 |
| InChI | InChI=1S/C15H18N2O2S/c1-4-17-15(16)20-8-11-7-14(18)19-13-6-10(3)9(2)5-12(11)13/h5-7H,4,8H2,1-3H3,(H2,16,17) |
| InChIKey | VCFAEBSDTMLLPB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 68.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|