C19H22N2O3S — CID 56827678
(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl N'-(oxolan-2-ylmethyl)carbamimidothioate (PubChem CID 56827678) has the molecular formula C19H22N2O3S and a molecular weight of 358.46 g/mol. Its IUPAC name is (2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl N'-(oxolan-2-ylmethyl)carbamimidothioate.
| Compound Name | (2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl N'-(oxolan-2-ylmethyl)carbamimidothioate |
|---|---|
| PubChem CID | 56827678 |
| Molecular Formula | C19H22N2O3S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | (2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl N'-(oxolan-2-ylmethyl)carbamimidothioate |
| SMILES | N/C(=N\CC1CCCO1)SCc1cc(=O)oc2cc3c(cc12)CCC3 |
| InChI | InChI=1S/C19H22N2O3S/c20-19(21-10-15-5-2-6-23-15)25-11-14-9-18(22)24-17-8-13-4-1-3-12(13)7-16(14)17/h7-9,15H,1-6,10-11H2,(H2,20,21) |
| InChIKey | XOPGRDRFQZLHKA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|