C19H21NO6S — CID 55359198
(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl 1-methylsulfonylpyrrolidine-2-carboxylate (PubChem CID 55359198) has the molecular formula C19H21NO6S and a molecular weight of 391.45 g/mol. Its IUPAC name is (2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl 1-methylsulfonylpyrrolidine-2-carboxylate.
| Compound Name | (2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl 1-methylsulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 55359198 |
| Molecular Formula | C19H21NO6S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | (2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl 1-methylsulfonylpyrrolidine-2-carboxylate |
| SMILES | CS(=O)(=O)N1CCCC1C(=O)OCc1cc(=O)oc2cc3c(cc12)CCC3 |
| InChI | InChI=1S/C19H21NO6S/c1-27(23,24)20-7-3-6-16(20)19(22)25-11-14-10-18(21)26-17-9-13-5-2-4-12(13)8-15(14)17/h8-10,16H,2-7,11H2,1H3 |
| InChIKey | NBWYPXXLCOVJPQ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|